C20H24F3NO3S — CID 135076486
(3,5-ditert-butyl-2-pyridin-2-ylphenyl) trifluoromethanesulfonate (PubChem CID 135076486) has the molecular formula C20H24F3NO3S and a molecular weight of 415.48 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-pyridin-2-ylphenyl) trifluoromethanesulfonate.
| Compound Name | (3,5-ditert-butyl-2-pyridin-2-ylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135076486 |
| Molecular Formula | C20H24F3NO3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (3,5-ditert-butyl-2-pyridin-2-ylphenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(OS(=O)(=O)C(F)(F)F)c(-c2ccccn2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24F3NO3S/c1-18(2,3)13-11-14(19(4,5)6)17(15-9-7-8-10-24-15)16(12-13)27-28(25,26)20(21,22)23/h7-12H,1-6H3 |
| InChIKey | LRXYLGOSLGMOPR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|