C16H19F3O5S — CID 135076776
[5-[(3,5-dimethoxyphenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate (PubChem CID 135076776) has the molecular formula C16H19F3O5S and a molecular weight of 380.38 g/mol. Its IUPAC name is [5-[(3,5-dimethoxyphenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate.
| Compound Name | [5-[(3,5-dimethoxyphenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135076776 |
| Molecular Formula | C16H19F3O5S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [5-[(3,5-dimethoxyphenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate |
| SMILES | COc1cc(CC2(C)CCC=C2OS(=O)(=O)C(F)(F)F)cc(OC)c1 |
| InChI | InChI=1S/C16H19F3O5S/c1-15(10-11-7-12(22-2)9-13(8-11)23-3)6-4-5-14(15)24-25(20,21)16(17,18)19/h5,7-9H,4,6,10H2,1-3H3 |
| InChIKey | SGUXOSJLGUIXOD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|