C17H15F2NO2 — CID 135077099
[(E)-1,1-bis(4-fluorophenyl)propan-2-ylideneamino] acetate (PubChem CID 135077099) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(E)-1,1-bis(4-fluorophenyl)propan-2-ylideneamino] acetate.
| Compound Name | [(E)-1,1-bis(4-fluorophenyl)propan-2-ylideneamino] acetate |
|---|---|
| PubChem CID | 135077099 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [(E)-1,1-bis(4-fluorophenyl)propan-2-ylideneamino] acetate |
| SMILES | CC(=O)O/N=C(\C)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2NO2/c1-11(20-22-12(2)21)17(13-3-7-15(18)8-4-13)14-5-9-16(19)10-6-14/h3-10,17H,1-2H3/b20-11+ |
| InChIKey | YHTHYCBQXIVUPT-RGVLZGJSSA-N |
| XLogP | 4.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|