C26H26OSi — CID 135077297
(2E)-6-methyl-1-triphenylsilylhepta-2,5-dien-1-one (PubChem CID 135077297) has the molecular formula C26H26OSi and a molecular weight of 382.58 g/mol. Its IUPAC name is (2E)-6-methyl-1-triphenylsilylhepta-2,5-dien-1-one.
| Compound Name | (2E)-6-methyl-1-triphenylsilylhepta-2,5-dien-1-one |
|---|---|
| PubChem CID | 135077297 |
| Molecular Formula | C26H26OSi |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2E)-6-methyl-1-triphenylsilylhepta-2,5-dien-1-one |
| SMILES | CC(C)=CC/C=C/C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26OSi/c1-22(2)14-12-13-21-26(27)28(23-15-6-3-7-16-23,24-17-8-4-9-18-24)25-19-10-5-11-20-25/h3-11,13-21H,12H2,1-2H3/b21-13+ |
| InChIKey | SNMWDKJAOIAEIF-FYJGNVAPSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|