C20H21F3N2O4S — CID 135077642
4-[1-ethenyl-6-(2-ethenylphenyl)pyridin-1-ium-3-yl]morpholine;trifluoromethanesulfonate (PubChem CID 135077642) has the molecular formula C20H21F3N2O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is 4-[1-ethenyl-6-(2-ethenylphenyl)pyridin-1-ium-3-yl]morpholine;trifluoromethanesulfonate.
| Compound Name | 4-[1-ethenyl-6-(2-ethenylphenyl)pyridin-1-ium-3-yl]morpholine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135077642 |
| Molecular Formula | C20H21F3N2O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-[1-ethenyl-6-(2-ethenylphenyl)pyridin-1-ium-3-yl]morpholine;trifluoromethanesulfonate |
| SMILES | C=Cc1ccccc1-c1ccc(N2CCOCC2)c[n+]1C=C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H21N2O.CHF3O3S/c1-3-16-7-5-6-8-18(16)19-10-9-17(15-20(19)4-2)21-11-13-22-14-12-21;2-1(3,4)8(5,6)7/h3-10,15H,1-2,11-14H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | PEFBBAFTHNJJEY-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|