C18H17F3N2O4S — CID 135005864
4-benzo[a]quinolizin-5-ium-3-ylmorpholine;trifluoromethanesulfonate (PubChem CID 135005864) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-benzo[a]quinolizin-5-ium-3-ylmorpholine;trifluoromethanesulfonate.
| Compound Name | 4-benzo[a]quinolizin-5-ium-3-ylmorpholine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135005864 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 4-benzo[a]quinolizin-5-ium-3-ylmorpholine;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc2c(c1)cc[n+]1cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C17H17N2O.CHF3O3S/c1-2-4-16-14(3-1)7-8-19-13-15(5-6-17(16)19)18-9-11-20-12-10-18;2-1(3,4)8(5,6)7/h1-8,13H,9-12H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | NTVDXALIFHYMIN-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 73.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|