C26H18F3NO3S — CID 139122193
6,7-diphenylbenzo[a]quinolizin-5-ium;trifluoromethanesulfonate (PubChem CID 139122193) has the molecular formula C26H18F3NO3S and a molecular weight of 481.50 g/mol. Its IUPAC name is 6,7-diphenylbenzo[a]quinolizin-5-ium;trifluoromethanesulfonate.
| Compound Name | 6,7-diphenylbenzo[a]quinolizin-5-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139122193 |
| Molecular Formula | C26H18F3NO3S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 6,7-diphenylbenzo[a]quinolizin-5-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2c(-c3ccccc3)[n+]3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C25H18N.CHF3O3S/c1-3-11-19(12-4-1)24-22-16-8-7-15-21(22)23-17-9-10-18-26(23)25(24)20-13-5-2-6-14-20;2-1(3,4)8(5,6)7/h1-18H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | CCRKJDIAPZYOMD-UHFFFAOYSA-M |
| XLogP | 5.96 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|