C18H8F7NO3S — CID 139050463
1,2,3,4-tetrafluoropyrido[1,2-f]phenanthridin-5-ium;trifluoromethanesulfonate (PubChem CID 139050463) has the molecular formula C18H8F7NO3S and a molecular weight of 451.32 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoropyrido[1,2-f]phenanthridin-5-ium;trifluoromethanesulfonate.
| Compound Name | 1,2,3,4-tetrafluoropyrido[1,2-f]phenanthridin-5-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139050463 |
| Molecular Formula | C18H8F7NO3S |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 1,2,3,4-tetrafluoropyrido[1,2-f]phenanthridin-5-ium;trifluoromethanesulfonate |
| SMILES | Fc1c(F)c(F)c2c(c1F)c1ccccc1c1cccc[n+]12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H8F4N.CHF3O3S/c18-13-12-10-6-2-1-5-9(10)11-7-3-4-8-22(11)17(12)16(21)15(20)14(13)19;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SRUXKMQBNMUPIG-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|