C16H14FN — CID 135077780
N-benzyl-2-fluoro-2,3-dihydroinden-1-imine (PubChem CID 135077780) has the molecular formula C16H14FN and a molecular weight of 239.29 g/mol. Its IUPAC name is N-benzyl-2-fluoro-2,3-dihydroinden-1-imine.
| Compound Name | N-benzyl-2-fluoro-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 135077780 |
| Molecular Formula | C16H14FN |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-benzyl-2-fluoro-2,3-dihydroinden-1-imine |
| SMILES | FC1Cc2ccccc2/C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C16H14FN/c17-15-10-13-8-4-5-9-14(13)16(15)18-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2/b18-16- |
| InChIKey | MVFOHQVNQAOVEN-VLGSPTGOSA-N |
| XLogP | 3.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|