C10H17BrO2 — CID 135078252
(2S,3R)-3-bromo-2-(3-methylbut-2-enoxy)oxane (PubChem CID 135078252) has the molecular formula C10H17BrO2 and a molecular weight of 249.15 g/mol. Its IUPAC name is (2S,3R)-3-bromo-2-(3-methylbut-2-enoxy)oxane.
| Compound Name | (2S,3R)-3-bromo-2-(3-methylbut-2-enoxy)oxane |
|---|---|
| PubChem CID | 135078252 |
| Molecular Formula | C10H17BrO2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (2S,3R)-3-bromo-2-(3-methylbut-2-enoxy)oxane |
| SMILES | CC(C)=CCO[C@@H]1OCCC[C@H]1Br |
| InChI | InChI=1S/C10H17BrO2/c1-8(2)5-7-13-10-9(11)4-3-6-12-10/h5,9-10H,3-4,6-7H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | TZNHQPMPMQYNOO-ZJUUUORDSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|