C20H18O4 — CID 135078259
methyl (2S,3S,5S)-7-oxo-2,5-diphenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 135078259) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl (2S,3S,5S)-7-oxo-2,5-diphenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | methyl (2S,3S,5S)-7-oxo-2,5-diphenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 135078259 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | methyl (2S,3S,5S)-7-oxo-2,5-diphenyl-6-oxabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(c3ccccc3)OC(=O)C2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-23-18(21)15-12-20(14-10-6-3-7-11-14)17(19(22)24-20)16(15)13-8-4-2-5-9-13/h2-11,15-17H,12H2,1H3/t15-,16-,17?,20+/m0/s1 |
| InChIKey | HAQQVBGNIATCJM-SEVYOHKTSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|