C11H18O5 — CID 135078442
(3-hydroxy-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 135078442) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3-hydroxy-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-hydroxy-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 135078442 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3-hydroxy-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)C)C=CC1O |
| InChI | InChI=1S/C11H18O5/c1-7(2)15-11-5-4-9(13)10(16-11)6-14-8(3)12/h4-5,7,9-11,13H,6H2,1-3H3 |
| InChIKey | JVXPLRJPIVDOAN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|