C16H32GeOSi — CID 135078607
tert-butyl-dimethyl-(1-trimethylgermylhept-6-en-1-yn-3-yloxy)silane (PubChem CID 135078607) has the molecular formula C16H32GeOSi and a molecular weight of 341.13 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1-trimethylgermylhept-6-en-1-yn-3-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1-trimethylgermylhept-6-en-1-yn-3-yloxy)silane |
|---|---|
| PubChem CID | 135078607 |
| Molecular Formula | C16H32GeOSi |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl-dimethyl-(1-trimethylgermylhept-6-en-1-yn-3-yloxy)silane |
| SMILES | C=CCCC(C#C[Ge](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32GeOSi/c1-10-11-12-15(13-14-17(5,6)7)18-19(8,9)16(2,3)4/h10,15H,1,11-12H2,2-9H3 |
| InChIKey | WSKDQKXVFLEWDC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|