C18H36GeOSi — CID 102240613
tert-butyl-(4,4-dimethyl-1-trimethylgermylhept-6-en-1-yn-3-yl)oxy-dimethylsilane (PubChem CID 102240613) has the molecular formula C18H36GeOSi and a molecular weight of 369.18 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethyl-1-trimethylgermylhept-6-en-1-yn-3-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(4,4-dimethyl-1-trimethylgermylhept-6-en-1-yn-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 102240613 |
| Molecular Formula | C18H36GeOSi |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl-(4,4-dimethyl-1-trimethylgermylhept-6-en-1-yn-3-yl)oxy-dimethylsilane |
| SMILES | C=CCC(C)(C)C(C#C[Ge](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36GeOSi/c1-12-14-18(5,6)16(13-15-19(7,8)9)20-21(10,11)17(2,3)4/h12,16H,1,14H2,2-11H3 |
| InChIKey | FTSNFHVVKILLLV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|