C22H25NO6 — CID 135078775
dimethyl 2-[[2-[(2,3-dimethoxyphenyl)methyl-methylamino]phenyl]methylidene]propanedioate (PubChem CID 135078775) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is dimethyl 2-[[2-[(2,3-dimethoxyphenyl)methyl-methylamino]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[2-[(2,3-dimethoxyphenyl)methyl-methylamino]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 135078775 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | dimethyl 2-[[2-[(2,3-dimethoxyphenyl)methyl-methylamino]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1ccccc1N(C)Cc1cccc(OC)c1OC)C(=O)OC |
| InChI | InChI=1S/C22H25NO6/c1-23(14-16-10-8-12-19(26-2)20(16)27-3)18-11-7-6-9-15(18)13-17(21(24)28-4)22(25)29-5/h6-13H,14H2,1-5H3 |
| InChIKey | BYLJHIZGDWPNPJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|