C8H14FO3P — CID 135080814
(1Z)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene (PubChem CID 135080814) has the molecular formula C8H14FO3P and a molecular weight of 208.17 g/mol. Its IUPAC name is (1Z)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene.
| Compound Name | (1Z)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene |
|---|---|
| PubChem CID | 135080814 |
| Molecular Formula | C8H14FO3P |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1Z)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene |
| SMILES | CCOP(=O)(/C(=C\C=C)/F)OCC |
| InChI | InChI=1S/C8H14FO3P/c1-4-7-8(9)13(10,11-5-2)12-6-3/h4,7H,1,5-6H2,2-3H3/b8-7- |
| InChIKey | QJPYZNMQFIGGGL-FPLPWBNLSA-N |
| XLogP | 1.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | 228 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|