C7H11NO — CID 135081124
(E,2R)-2-hydroxy-3-methylhex-3-enenitrile (PubChem CID 135081124) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (E,2R)-2-hydroxy-3-methylhex-3-enenitrile.
| Compound Name | (E,2R)-2-hydroxy-3-methylhex-3-enenitrile |
|---|---|
| PubChem CID | 135081124 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (E,2R)-2-hydroxy-3-methylhex-3-enenitrile |
| SMILES | CC/C=C(\C)[C@@H](O)C#N |
| InChI | InChI=1S/C7H11NO/c1-3-4-6(2)7(9)5-8/h4,7,9H,3H2,1-2H3/b6-4+/t7-/m0/s1 |
| InChIKey | HGMIGIKSXHEIFA-KNIZRNDPSA-N |
| XLogP | 1.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|