C11H12ClNO6 — CID 135082180
5-methyl-3-(phenoxymethyl)-1,2-oxazol-2-ium perchlorate (PubChem CID 135082180) has the molecular formula C11H12ClNO6 and a molecular weight of 289.67 g/mol. Its IUPAC name is 5-methyl-3-(phenoxymethyl)-1,2-oxazol-2-ium perchlorate.
| Compound Name | 5-methyl-3-(phenoxymethyl)-1,2-oxazol-2-ium perchlorate |
|---|---|
| PubChem CID | 135082180 |
| Molecular Formula | C11H12ClNO6 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-methyl-3-(phenoxymethyl)-1,2-oxazol-2-ium perchlorate |
| SMILES | Cc1cc(COc2ccccc2)[nH+]o1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H11NO2.ClHO4/c1-9-7-10(12-14-9)8-13-11-5-3-2-4-6-11;2-1(3,4)5/h2-7H,8H2,1H3;(H,2,3,4,5) |
| InChIKey | BXESETDOZLPHGW-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |