C14H9N3 — CID 135082282
12,16,17-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 135082282) has the molecular formula C14H9N3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 12,16,17-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 12,16,17-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 135082282 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 12,16,17-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=NC2=CC=NC3=c4ccccc4=CC(=C1)N23 |
| InChI | InChI=1S/C14H9N3/c1-2-4-12-10(3-1)9-11-5-7-15-13-6-8-16-14(12)17(11)13/h1-9H |
| InChIKey | ZBHSWZMHAAHCLY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |