About dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+))
dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) (PubChem CID 135082659) has the molecular formula C31H28Au2NP2+
and a molecular weight of 870.45 g/mol. Its IUPAC name is dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)).
Molecular Properties
| Compound Name | dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) |
| PubChem CID | 135082659 |
| Molecular Formula | C31H28Au2NP2+ |
| Molecular Weight | 870.45 g/mol |
| Exact Mass | 870.10 |
| IUPAC Name | dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) |
| SMILES | [Au+].[Au+].[CH2-][P+]([CH2-])(c1ccccc1)c1ccccc1.c1ccc(P(c2ccccc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H14NP.C14H14P.2Au/c1-3-9-15(10-4-1)19(16-11-5-2-6-12-16)17-13-7-8-14-18-17;1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;;/h1-14H;3-12H,1-2H2;;/q;-1;2*+1 |
| InChIKey | LKRHFNDIESSNLQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 870.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+))?
The IUPAC name of dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) (CID 135082659) is dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)).
What is the SMILES notation for dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+))?
The canonical SMILES for dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) is [Au+].[Au+].[CH2-][P+]([CH2-])(c1ccccc1)c1ccccc1.c1ccc(P(c2ccccc2)c2ccccn2)cc1.
What is the InChIKey of dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+))?
The InChIKey is LKRHFNDIESSNLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14NP.C14H14P.2Au/c1-3-9-15(10-4-1)19(16-11-5-2-6-12-16)17-13-7-8-14-18-17;1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;;/h1-14H;3-12H,1-2H2;;/q;-1;2*+1.
What are the key properties of dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+))?
dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) has a molecular weight of 870.45 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethanidyl(diphenyl)phosphanium;diphenyl(pyridin-2-yl)phosphane;bis(gold(1+)) is sourced from PubChem (CID 135082659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).