C28H36O11 — CID 135083034
(3R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[[3,4-dimethoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]oxolan-2-one (PubChem CID 135083034) has the molecular formula C28H36O11 and a molecular weight of 548.59 g/mol. Its IUPAC name is (3R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[[3,4-dimethoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]oxolan-2-one.
| Compound Name | (3R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[[3,4-dimethoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 135083034 |
| Molecular Formula | C28H36O11 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (3R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[[3,4-dimethoxy-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]oxolan-2-one |
| SMILES | COc1ccc(CC2COC(=O)[C@@H]2Cc2cc(OC)c(OC)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1OC |
| InChI | InChI=1S/C28H36O11/c1-34-19-6-5-14(10-20(19)35-2)7-16-13-38-28(33)17(16)8-15-9-18(26(37-4)21(11-15)36-3)27-25(32)24(31)23(30)22(12-29)39-27/h5-6,9-11,16-17,22-25,27,29-32H,7-8,12-13H2,1-4H3/t16?,17-,22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | KQKLLBVOWSTIFZ-LPIDHOMPSA-N |
| XLogP | 0.81 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |