C15H20O2 — CID 135083777
(2S)-2-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4-ethenyl-2H-furan-5-one (PubChem CID 135083777) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2S)-2-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4-ethenyl-2H-furan-5-one.
| Compound Name | (2S)-2-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4-ethenyl-2H-furan-5-one |
|---|---|
| PubChem CID | 135083777 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S)-2-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4-ethenyl-2H-furan-5-one |
| SMILES | C=CC1=C[C@@H](C(C)(C)C/C=C/C(=C)C)OC1=O |
| InChI | InChI=1S/C15H20O2/c1-6-12-10-13(17-14(12)16)15(4,5)9-7-8-11(2)3/h6-8,10,13H,1-2,9H2,3-5H3/b8-7+/t13-/m0/s1 |
| InChIKey | KMAJDUBTSBLALO-GWJCSSMESA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|