C21H29IrNOP- — CID 135085548
carbanide;diphenyl-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phosphanium;iridium (PubChem CID 135085548) has the molecular formula C21H29IrNOP- and a molecular weight of 534.66 g/mol. Its IUPAC name is carbanide;diphenyl-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phosphanium;iridium.
| Compound Name | carbanide;diphenyl-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phosphanium;iridium |
|---|---|
| PubChem CID | 135085548 |
| Molecular Formula | C21H29IrNOP- |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | carbanide;diphenyl-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phosphanium;iridium |
| SMILES | CC(C)[C@H]1COC(C[PH+](c2ccccc2)c2ccccc2)=N1.[CH3-].[CH3-].[Ir] |
| InChI | InChI=1S/C19H22NOP.2CH3.Ir/c1-15(2)18-13-21-19(20-18)14-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17;;;/h3-12,15,18H,13-14H2,1-2H3;2*1H3;/q;2*-1;/p+1/t18-;;;/m1.../s1 |
| InChIKey | QPTPDTQTLYQAQU-YTNSDAIYSA-O |
| XLogP | 4.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|