C25H32NOP — CID 164669043
[(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclohexyl]-diphenylphosphane (PubChem CID 164669043) has the molecular formula C25H32NOP and a molecular weight of 393.51 g/mol. Its IUPAC name is [(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclohexyl]-diphenylphosphane.
| Compound Name | [(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclohexyl]-diphenylphosphane |
|---|---|
| PubChem CID | 164669043 |
| Molecular Formula | C25H32NOP |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [(1S,2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]cyclohexyl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@H]1COC([C@@H]2CCCC[C@@H]2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C25H32NOP/c1-25(2,3)23-18-27-24(26-23)21-16-10-11-17-22(21)28(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,21-23H,10-11,16-18H2,1-3H3/t21-,22+,23-/m1/s1 |
| InChIKey | HHOPOTVFXDYSFB-XPWALMASSA-N |
| XLogP | 5.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|