C12H21BrO2Zn — CID 135085643
bromozinc(1+);(3E)-5-(methoxymethoxy)deca-1,3-diene (PubChem CID 135085643) has the molecular formula C12H21BrO2Zn and a molecular weight of 342.59 g/mol. Its IUPAC name is bromozinc(1+);(3E)-5-(methoxymethoxy)deca-1,3-diene.
| Compound Name | bromozinc(1+);(3E)-5-(methoxymethoxy)deca-1,3-diene |
|---|---|
| PubChem CID | 135085643 |
| Molecular Formula | C12H21BrO2Zn |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | bromozinc(1+);(3E)-5-(methoxymethoxy)deca-1,3-diene |
| SMILES | [H]/[C-]=C\C=C\C(CCCCC)OCOC.[Zn+]Br |
| InChI | InChI=1S/C12H21O2.BrH.Zn/c1-4-6-8-10-12(9-7-5-2)14-11-13-3;;/h2,5,7,9,12H,4,6,8,10-11H2,1,3H3;1H;/q-1;;+2/p-1/b9-7+;; |
| InChIKey | NXYJPPYUDFAXSR-OJYIHNBOSA-M |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|