C15H25BrO2Zn — CID 135075875
bromozinc(1+);2-[(3E)-deca-1,3-dien-5-yl]oxyoxane (PubChem CID 135075875) has the molecular formula C15H25BrO2Zn and a molecular weight of 382.66 g/mol. Its IUPAC name is bromozinc(1+);2-[(3E)-deca-1,3-dien-5-yl]oxyoxane.
| Compound Name | bromozinc(1+);2-[(3E)-deca-1,3-dien-5-yl]oxyoxane |
|---|---|
| PubChem CID | 135075875 |
| Molecular Formula | C15H25BrO2Zn |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | bromozinc(1+);2-[(3E)-deca-1,3-dien-5-yl]oxyoxane |
| SMILES | [H]/[C-]=C\C=C\C(CCCCC)OC1CCCCO1.[Zn+]Br |
| InChI | InChI=1S/C15H25O2.BrH.Zn/c1-3-5-7-11-14(10-6-4-2)17-15-12-8-9-13-16-15;;/h2,4,6,10,14-15H,3,5,7-9,11-13H2,1H3;1H;/q-1;;+2/p-1/b10-6+;; |
| InChIKey | HOEGMGJTBLQJLZ-DOLBFOAYSA-M |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|