C11H16O2 — CID 143245620
(4R)-4-cyclohexa-1,3-dien-1-yl-2-methyl-1,3-dioxane (PubChem CID 143245620) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (4R)-4-cyclohexa-1,3-dien-1-yl-2-methyl-1,3-dioxane.
| Compound Name | (4R)-4-cyclohexa-1,3-dien-1-yl-2-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 143245620 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (4R)-4-cyclohexa-1,3-dien-1-yl-2-methyl-1,3-dioxane |
| SMILES | CC1OCC[C@H](C2=CC=CCC2)O1 |
| InChI | InChI=1S/C11H16O2/c1-9-12-8-7-11(13-9)10-5-3-2-4-6-10/h2-3,5,9,11H,4,6-8H2,1H3/t9?,11-/m1/s1 |
| InChIKey | GAZHJSGRXYEBNQ-HCCKASOXSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |