C20H31F3O4 — CID 56611565
5-octoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56611565) has the molecular formula C20H31F3O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-octoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-octoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56611565 |
| Molecular Formula | C20H31F3O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 5-octoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCCCOC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C20H31F3O4/c1-2-3-4-5-6-7-12-24-18-13-25-19(26-14-18)16-8-10-17(11-9-16)27-15-20(21,22)23/h8-10,17-19H,2-7,11-15H2,1H3 |
| InChIKey | MQXGCEPFTLPXBQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|