C16H22N4O4S — CID 135088798
N-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 135088798) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 135088798 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | COCC(NC(=O)c1ccc(N(C)S(C)(=O)=O)cc1)c1ccnn1C |
| InChI | InChI=1S/C16H22N4O4S/c1-19-15(9-10-17-19)14(11-24-3)18-16(21)12-5-7-13(8-6-12)20(2)25(4,22)23/h5-10,14H,11H2,1-4H3,(H,18,21) |
| InChIKey | MWTFINUXGXYTTD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |