C14H17FN4O4S — CID 97138029
2-fluoro-N-[(1R)-2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-5-sulfamoylbenzamide (PubChem CID 97138029) has the molecular formula C14H17FN4O4S and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-5-sulfamoylbenzamide.
| Compound Name | 2-fluoro-N-[(1R)-2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 97138029 |
| Molecular Formula | C14H17FN4O4S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-fluoro-N-[(1R)-2-methoxy-1-(2-methylpyrazol-3-yl)ethyl]-5-sulfamoylbenzamide |
| SMILES | COC[C@H](NC(=O)c1cc(S(N)(=O)=O)ccc1F)c1ccnn1C |
| InChI | InChI=1S/C14H17FN4O4S/c1-19-13(5-6-17-19)12(8-23-2)18-14(20)10-7-9(24(16,21)22)3-4-11(10)15/h3-7,12H,8H2,1-2H3,(H,18,20)(H2,16,21,22)/t12-/m0/s1 |
| InChIKey | ZCFQMXJXBQXBDB-LBPRGKRZSA-N |
| XLogP | 0.32 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |