C32H46N6O5 — CID 135090060
(3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(pyridin-2-ylmethyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 135090060) has the molecular formula C32H46N6O5 and a molecular weight of 594.76 g/mol. Its IUPAC name is (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(pyridin-2-ylmethyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(pyridin-2-ylmethyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135090060 |
| Molecular Formula | C32H46N6O5 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(pyridin-2-ylmethyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@H](CC(C)C)NC(=O)CN(Cc3ccccn3)C[C@H](C(C)C)NC(=O)[C@@H](C)NC2=O)cc1 |
| InChI | InChI=1S/C32H46N6O5/c1-20(2)15-26-32(42)36-27(16-23-10-12-25(43-6)13-11-23)31(41)34-22(5)30(40)37-28(21(3)4)18-38(19-29(39)35-26)17-24-9-7-8-14-33-24/h7-14,20-22,26-28H,15-19H2,1-6H3,(H,34,41)(H,35,39)(H,36,42)(H,37,40)/t22-,26+,27+,28-/m1/s1 |
| InChIKey | UINIPCGCGGDYQF-CSZVXOJQSA-N |
| XLogP | 1.81 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |