C31H43N5O6S — CID 135118854
(3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(thiophene-3-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 135118854) has the molecular formula C31H43N5O6S and a molecular weight of 613.78 g/mol. Its IUPAC name is (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(thiophene-3-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(thiophene-3-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135118854 |
| Molecular Formula | C31H43N5O6S |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | (3R,6S,9S,15S)-6-[(4-methoxyphenyl)methyl]-3-methyl-9-(2-methylpropyl)-15-propan-2-yl-13-(thiophene-3-carbonyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@H](CC(C)C)NC(=O)CN(C(=O)c3ccsc3)C[C@H](C(C)C)NC(=O)[C@@H](C)NC2=O)cc1 |
| InChI | InChI=1S/C31H43N5O6S/c1-18(2)13-24-30(40)34-25(14-21-7-9-23(42-6)10-8-21)29(39)32-20(5)28(38)35-26(19(3)4)15-36(16-27(37)33-24)31(41)22-11-12-43-17-22/h7-12,17-20,24-26H,13-16H2,1-6H3,(H,32,39)(H,33,37)(H,34,40)(H,35,38)/t20-,24+,25+,26-/m1/s1 |
| InChIKey | WBHWJYXNKGBDNP-IFKAHUTRSA-N |
| XLogP | 2.12 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |