C18H22N6O3 — CID 135092398
N-[[(1S,5S,6R,7R)-3-(4-aminopyrimidin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 135092398) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(4-aminopyrimidin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(4-aminopyrimidin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135092398 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(4-aminopyrimidin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@H]2[C@H]3CN(c4nccc(N)n4)C[C@]34CC[C@H]2O4)no1 |
| InChI | InChI=1S/C18H22N6O3/c1-10-6-13(23-27-10)16(25)21-7-11-12-8-24(17-20-5-3-15(19)22-17)9-18(12)4-2-14(11)26-18/h3,5-6,11-12,14H,2,4,7-9H2,1H3,(H,21,25)(H2,19,20,22)/t11-,12+,14+,18+/m0/s1 |
| InChIKey | LJOLVIOXXBIUQA-NMFBSDBYSA-N |
| XLogP | 0.77 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |