C22H29N3O4 — CID 155508389
5-methyl-N-[[(1S,5S,6R,7R)-3-[(5-propylfuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 155508389) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 5-methyl-N-[[(1S,5S,6R,7R)-3-[(5-propylfuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[[(1S,5S,6R,7R)-3-[(5-propylfuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 155508389 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 5-methyl-N-[[(1S,5S,6R,7R)-3-[(5-propylfuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCCc1ccc(CN2C[C@@H]3[C@H](CNC(=O)c4cc(C)on4)[C@H]4CC[C@]3(C2)O4)o1 |
| InChI | InChI=1S/C22H29N3O4/c1-3-4-15-5-6-16(27-15)11-25-12-18-17(20-7-8-22(18,13-25)28-20)10-23-21(26)19-9-14(2)29-24-19/h5-6,9,17-18,20H,3-4,7-8,10-13H2,1-2H3,(H,23,26)/t17-,18+,20+,22+/m0/s1 |
| InChIKey | ZOKXYSURYJVQRM-XHYAQGIWSA-N |
| XLogP | 2.94 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |