C18H22N4O3S — CID 154817277
N-[[(1S,5S,6R,7R)-3-(furan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 154817277) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(furan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(furan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 154817277 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(furan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | Cc1nsnc1C(=O)NC[C@H]1[C@H]2CN(Cc3ccco3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C18H22N4O3S/c1-11-16(21-26-20-11)17(23)19-7-13-14-9-22(8-12-3-2-6-24-12)10-18(14)5-4-15(13)25-18/h2-3,6,13-15H,4-5,7-10H2,1H3,(H,19,23)/t13-,14+,15+,18+/m0/s1 |
| InChIKey | ATKQXOXAZWTNMD-LUXYFRNMSA-N |
| XLogP | 1.85 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |