C19H24ClN5O3 — CID 169419841
N-[[(1S,5S,6R,7R)-3-[(5-chlorofuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-(1,2,4-triazol-4-yl)propanamide (PubChem CID 169419841) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(5-chlorofuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-(1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(5-chlorofuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-(1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 169419841 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(5-chlorofuran-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-(1,2,4-triazol-4-yl)propanamide |
| SMILES | O=C(CCn1cnnc1)NC[C@H]1[C@H]2CN(Cc3ccc(Cl)o3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C19H24ClN5O3/c20-17-2-1-13(27-17)8-25-9-15-14(16-3-5-19(15,10-25)28-16)7-21-18(26)4-6-24-11-22-23-12-24/h1-2,11-12,14-16H,3-10H2,(H,21,26)/t14-,15+,16+,19+/m0/s1 |
| InChIKey | GYUHIHGMPRMANX-WFXMFSGNSA-N |
| XLogP | 1.71 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |