C21H30N2O2S — CID 171150724
N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]hept-5-enamide (PubChem CID 171150724) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]hept-5-enamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]hept-5-enamide |
|---|---|
| PubChem CID | 171150724 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]hept-5-enamide |
| SMILES | CC=CCCCC(=O)NC[C@H]1[C@H]2CN(Cc3cccs3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C21H30N2O2S/c1-2-3-4-5-8-20(24)22-12-17-18-14-23(13-16-7-6-11-26-16)15-21(18)10-9-19(17)25-21/h2-3,6-7,11,17-19H,4-5,8-10,12-15H2,1H3,(H,22,24)/t17-,18+,19+,21+/m0/s1 |
| InChIKey | CSUHAYLEJRRUDJ-QEUVDIPISA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|