C21H25N3O3S — CID 155502672
2-phenoxy-N-[[(1S,5S,6R,7R)-3-(1,3-thiazol-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide (PubChem CID 155502672) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-phenoxy-N-[[(1S,5S,6R,7R)-3-(1,3-thiazol-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide.
| Compound Name | 2-phenoxy-N-[[(1S,5S,6R,7R)-3-(1,3-thiazol-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 155502672 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-phenoxy-N-[[(1S,5S,6R,7R)-3-(1,3-thiazol-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
| SMILES | O=C(COc1ccccc1)NC[C@H]1[C@H]2CN(Cc3nccs3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C21H25N3O3S/c25-19(13-26-15-4-2-1-3-5-15)23-10-16-17-11-24(12-20-22-8-9-28-20)14-21(17)7-6-18(16)27-21/h1-5,8-9,16-18H,6-7,10-14H2,(H,23,25)/t16-,17+,18+,21+/m0/s1 |
| InChIKey | SXTAYTULVKQATN-XKGFGPFHSA-N |
| XLogP | 2.32 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |