C22H32N2O3 — CID 155917324
N-[[(1S,5S,6R,7R)-3-(3-phenylmethoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide (PubChem CID 155917324) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(3-phenylmethoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(3-phenylmethoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
|---|---|
| PubChem CID | 155917324 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(3-phenylmethoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
| SMILES | CCC(=O)NC[C@H]1[C@H]2CN(CCCOCc3ccccc3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C22H32N2O3/c1-2-21(25)23-13-18-19-14-24(16-22(19)10-9-20(18)27-22)11-6-12-26-15-17-7-4-3-5-8-17/h3-5,7-8,18-20H,2,6,9-16H2,1H3,(H,23,25)/t18-,19+,20+,22+/m0/s1 |
| InChIKey | VVYASYFPMURVSY-GPQLQYNLSA-N |
| XLogP | 2.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|