C21H28F2N2O5 — CID 155938353
N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide;formic acid (PubChem CID 155938353) has the molecular formula C21H28F2N2O5 and a molecular weight of 426.46 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide;formic acid.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide;formic acid |
|---|---|
| PubChem CID | 155938353 |
| Molecular Formula | C21H28F2N2O5 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide;formic acid |
| SMILES | CCOCCN1C[C@@H]2[C@H](CNC(=O)c3cccc(F)c3F)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C20H26F2N2O3.CH2O2/c1-2-26-9-8-24-11-15-14(17-6-7-20(15,12-24)27-17)10-23-19(25)13-4-3-5-16(21)18(13)22;2-1-3/h3-5,14-15,17H,2,6-12H2,1H3,(H,23,25);1H,(H,2,3)/t14-,15+,17+,20+;/m0./s1 |
| InChIKey | MQRHTJDWDYVQJD-ZJQPJNKMSA-N |
| XLogP | 1.91 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|