C23H32N2O3 — CID 155499617
3-methoxy-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide (PubChem CID 155499617) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-methoxy-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 155499617 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-methoxy-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide |
| SMILES | COc1cccc(C(=O)NC[C@H]2[C@H]3CN(CCC=C(C)C)C[C@]34CC[C@H]2O4)c1 |
| InChI | InChI=1S/C23H32N2O3/c1-16(2)6-5-11-25-14-20-19(21-9-10-23(20,15-25)28-21)13-24-22(26)17-7-4-8-18(12-17)27-3/h4,6-8,12,19-21H,5,9-11,13-15H2,1-3H3,(H,24,26)/t19-,20+,21+,23+/m0/s1 |
| InChIKey | ZUIIKUVLWKWCOT-ZZLPTCMGSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|