C21H27ClN2O2 — CID 154818591
4-chloro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide (PubChem CID 154818591) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 4-chloro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 154818591 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-chloro-N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzamide |
| SMILES | CC(C)=CCN1C[C@@H]2[C@H](CNC(=O)c3ccc(Cl)cc3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C21H27ClN2O2/c1-14(2)8-10-24-12-18-17(19-7-9-21(18,13-24)26-19)11-23-20(25)15-3-5-16(22)6-4-15/h3-6,8,17-19H,7,9-13H2,1-2H3,(H,23,25)/t17-,18+,19+,21+/m0/s1 |
| InChIKey | PORKEZOKGPRSMD-QEUVDIPISA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|