C21H30N2O4S — CID 155939266
formic acid;N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide (PubChem CID 155939266) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is formic acid;N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide.
| Compound Name | formic acid;N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 155939266 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | formic acid;N-[[(1S,5S,6R,7R)-3-(3-methylbut-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-thiophen-3-ylacetamide |
| SMILES | CC(C)=CCN1C[C@@H]2[C@H](CNC(=O)Cc3ccsc3)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C20H28N2O2S.CH2O2/c1-14(2)4-7-22-11-17-16(18-3-6-20(17,13-22)24-18)10-21-19(23)9-15-5-8-25-12-15;2-1-3/h4-5,8,12,16-18H,3,6-7,9-11,13H2,1-2H3,(H,21,23);1H,(H,2,3)/t16-,17+,18+,20+;/m0./s1 |
| InChIKey | OHKCUXCSQUISTE-DUPLWUEISA-N |
| XLogP | 2.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|