C19H22N4O3S2 — CID 155508806
4-methyl-N-[[(1S,5S,6R,7R)-3-(2-thiophen-3-ylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2,5-thiadiazole-3-carboxamide (PubChem CID 155508806) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-methyl-N-[[(1S,5S,6R,7R)-3-(2-thiophen-3-ylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | 4-methyl-N-[[(1S,5S,6R,7R)-3-(2-thiophen-3-ylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 155508806 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-methyl-N-[[(1S,5S,6R,7R)-3-(2-thiophen-3-ylacetyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2,5-thiadiazole-3-carboxamide |
| SMILES | Cc1nsnc1C(=O)NC[C@H]1[C@H]2CN(C(=O)Cc3ccsc3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C19H22N4O3S2/c1-11-17(22-28-21-11)18(25)20-7-13-14-8-23(10-19(14)4-2-15(13)26-19)16(24)6-12-3-5-27-9-12/h3,5,9,13-15H,2,4,6-8,10H2,1H3,(H,20,25)/t13-,14+,15+,19+/m0/s1 |
| InChIKey | PRDNCPOHDUWPKT-NRTGNBEESA-N |
| XLogP | 1.89 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |