C20H24N4O2S — CID 155492884
5-methyl-N-[[(1S,5S,6R,7R)-3-(thiophen-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide (PubChem CID 155492884) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 5-methyl-N-[[(1S,5S,6R,7R)-3-(thiophen-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[[(1S,5S,6R,7R)-3-(thiophen-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155492884 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 5-methyl-N-[[(1S,5S,6R,7R)-3-(thiophen-3-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC[C@H]2[C@H]3CN(Cc4ccsc4)C[C@]34CC[C@H]2O4)cn1 |
| InChI | InChI=1S/C20H24N4O2S/c1-13-6-22-17(8-21-13)19(25)23-7-15-16-10-24(9-14-3-5-27-11-14)12-20(16)4-2-18(15)26-20/h3,5-6,8,11,15-16,18H,2,4,7,9-10,12H2,1H3,(H,23,25)/t15-,16+,18+,20+/m0/s1 |
| InChIKey | COMCOZPUIFLSAV-IXIUHKBRSA-N |
| XLogP | 2.26 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |