C17H23N3O2S — CID 155501440
N-[[(1S,5S,6R,7R)-3-(cyclopropylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 155501440) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(cyclopropylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(cyclopropylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155501440 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(cyclopropylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC[C@H]1[C@H]2CN(CC3CC3)C[C@]23CC[C@H]1O3)c1cscn1 |
| InChI | InChI=1S/C17H23N3O2S/c21-16(14-8-23-10-19-14)18-5-12-13-7-20(6-11-1-2-11)9-17(13)4-3-15(12)22-17/h8,10-13,15H,1-7,9H2,(H,18,21)/t12-,13+,15+,17+/m0/s1 |
| InChIKey | WDDJCSMZMMGHQJ-TZDHZFECSA-N |
| XLogP | 1.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |