C20H29N3O3 — CID 154821843
N-[[(1S,5S,6R,7R)-3-[(E)-but-2-enyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-propyl-1,2-oxazole-3-carboxamide (PubChem CID 154821843) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(E)-but-2-enyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-propyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(E)-but-2-enyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-propyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 154821843 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(E)-but-2-enyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-propyl-1,2-oxazole-3-carboxamide |
| SMILES | C/C=C/CN1C[C@@H]2[C@H](CNC(=O)c3cc(CCC)on3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C20H29N3O3/c1-3-5-9-23-12-16-15(18-7-8-20(16,13-23)25-18)11-21-19(24)17-10-14(6-4-2)26-22-17/h3,5,10,15-16,18H,4,6-9,11-13H2,1-2H3,(H,21,24)/b5-3+/t15-,16+,18+,20+/m0/s1 |
| InChIKey | QUBACKVBSNJQQU-QGGWNXCUSA-N |
| XLogP | 2.41 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|