C22H29N3O3S — CID 155491427
5-ethyl-N-[[(1S,5S,6R,7R)-3-[(5-ethylthiophen-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 155491427) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 5-ethyl-N-[[(1S,5S,6R,7R)-3-[(5-ethylthiophen-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-ethyl-N-[[(1S,5S,6R,7R)-3-[(5-ethylthiophen-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 155491427 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 5-ethyl-N-[[(1S,5S,6R,7R)-3-[(5-ethylthiophen-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCc1cc(C(=O)NC[C@H]2[C@H]3CN(Cc4ccc(CC)s4)C[C@]34CC[C@H]2O4)no1 |
| InChI | InChI=1S/C22H29N3O3S/c1-3-14-9-19(24-28-14)21(26)23-10-17-18-12-25(11-16-6-5-15(4-2)29-16)13-22(18)8-7-20(17)27-22/h5-6,9,17-18,20H,3-4,7-8,10-13H2,1-2H3,(H,23,26)/t17-,18+,20+,22+/m0/s1 |
| InChIKey | BMBCKWPQAKBZGX-XHYAQGIWSA-N |
| XLogP | 3.27 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |