C20H25N3O3S — CID 154820949
N-[[(1S,5S,6R,7R)-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide (PubChem CID 154820949) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 154820949 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3-ethyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide |
| SMILES | CCc1cc(CN2C[C@@H]3[C@H](CNC(=O)c4ccsc4)[C@H]4CC[C@]3(C2)O4)on1 |
| InChI | InChI=1S/C20H25N3O3S/c1-2-14-7-15(26-22-14)9-23-10-17-16(18-3-5-20(17,12-23)25-18)8-21-19(24)13-4-6-27-11-13/h4,6-7,11,16-18H,2-3,5,8-10,12H2,1H3,(H,21,24)/t16-,17+,18+,20+/m0/s1 |
| InChIKey | HWDIQZLTCNNONR-JRBPQWBISA-N |
| XLogP | 2.71 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |