C20H25N3O3S — CID 169416983
5-ethyl-N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 169416983) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 5-ethyl-N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-ethyl-N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 169416983 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 5-ethyl-N-[[(1S,5S,6R,7R)-3-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCc1cc(C(=O)NC[C@H]2[C@H]3CN(Cc4cccs4)C[C@]34CC[C@H]2O4)no1 |
| InChI | InChI=1S/C20H25N3O3S/c1-2-13-8-17(22-26-13)19(24)21-9-15-16-11-23(10-14-4-3-7-27-14)12-20(16)6-5-18(15)25-20/h3-4,7-8,15-16,18H,2,5-6,9-12H2,1H3,(H,21,24)/t15-,16+,18+,20+/m0/s1 |
| InChIKey | TVSJDYWCQBBIDF-IXIUHKBRSA-N |
| XLogP | 2.71 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |